Molecular Definition

Canonical SMILES [H][C@@](C)(C[C@]1([H])CC[C@@]([H])(OCCO)[C@@H](C1)OC)[C@]1([H])CC(=O)[C@H](C)\C=C(C)\[C@@H](O)[C@@H](OC)C(=O)[C@H](C)C[C@H](C)\C=C\C=C\C=C(C)\[C@H](C[C@]2([H])CC[C@@]([H])(C)[C@@](O)(O2)C(=O)C(=O)N2CCCC[C@@]2([H])C(=O)O1)OC
Formula C53H83NO14
Molecular Weight 958.22 da
Stereocenters 15/15