Target Relevance

Molecular Definition

Canonical SMILES [H][C@@]12CC[C@H](OC(=O)CCCC)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(O)C=C3
Formula C23H32O3
Molecular Weight 356.50 da
Stereocenters 5/5