Molecular Definition

Canonical SMILES COC1=CC=C2N=C(NC2=C1)[S@@](=O)CC1=C(C)C(OC)=C(C)C=N1
Formula C17H19N3O3S
Molecular Weight 345.42 da
Stereocenters 1/1