Molecular Definition

Canonical SMILES OC[C@H]1O[C@H]([C@H](O)[C@@H](O)[C@@H]1O)C1=CC(CC2=CC=C(O[C@H]3CCOC3)C=C2)=C(Cl)C=C1
Formula C23H27ClO7
Molecular Weight 450.91 da
Stereocenters 6/6