Target Relevance

Molecular Definition

Canonical SMILES CC[N+](C)(C)C1=CC=CC(O)=C1
Formula C10H16NO
Molecular Weight 166.24 da
Stereocenters 0/1