Molecular Definition

Canonical SMILES [H][C@@]1(C[C@H](N)[C@H](O)[C@H](C)O1)O[C@H]1C[C@@](O)(CC2=C(O)C3=C(C(O)=C12)C(=O)C1=C(OC)C=CC=C1C3=O)C(=O)CO
Formula C27H29NO11
Molecular Weight 543.52 da
Stereocenters 6/6