Molecular Definition

Canonical SMILES CCN(CC)C(=S)SSC(=S)N(CC)CC
Formula C10H20N2S4
Molecular Weight 296.54 da
Stereocenters 0/0