Molecular Definition

Canonical SMILES CN1C2=C(N(CC(O)CO)C=N2)C(=O)N(C)C1=O
Formula C10H14N4O4
Molecular Weight 254.24 da
Stereocenters 0/1