Molecular Definition

Canonical SMILES C[N+]1(C)CCC(CC1)=C(C1=CC=CC=C1)C1=CC=CC=C1
Formula C20H24N
Molecular Weight 278.41 da
Stereocenters 0/1