Molecular Definition

Canonical SMILES CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1C\C=C/CCCC(O)=O
Formula C20H32O5
Molecular Weight 352.47 da
Stereocenters 4/4