Molecular Definition

Canonical SMILES CN1C[C@@H](C[C@H]2[C@H]1Cc1c[nH]c3c1c2ccc3)C(=O)N[C@]1(C)O[C@@]2(N(C1=O)[C@@H](Cc1ccccc1)C(=O)N1[C@H]2CCC1)O
Formula C33H37N5O5
Molecular Weight 583.68 da
Stereocenters 7/7