Molecular Definition

Canonical SMILES OC1=C(CC2=C(O)C3=C(OC2=O)C=CC=C3)C(=O)OC2=CC=CC=C12
Formula C19H12O6
Molecular Weight 336.30 da
Stereocenters 0/0