Molecular Definition

Canonical SMILES OC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl
Formula C14H11Cl2NO2
Molecular Weight 296.15 da
Stereocenters 0/0