Molecular Definition

Canonical SMILES CN1C2=CC=C(Cl)C=C2C(=NCC1=O)C1=CC=CC=C1
Formula C16H13ClN2O
Molecular Weight 284.74 da
Stereocenters 0/0