Molecular Definition

Canonical SMILES N[C@H](CC1=CC(I)=C(OC2=CC(I)=C(O)C(I)=C2)C(I)=C1)C(O)=O
Formula C15H11I4NO4
Molecular Weight 776.87 da
Stereocenters 1/1