Molecular Definition

Canonical SMILES COCCCOC1=CC=NC(C[S@@](=O)C2=NC3=C(N2)C=CC=C3)=C1C
Formula C18H21N3O3S
Molecular Weight 359.44 da
Stereocenters 1/1