Molecular Definition

Canonical SMILES O=C1CC[C@@](C2CCN(CC3=CC=CC=C3)CC2)(C(=O)N1)C1=CC=CC=C1
Formula C23H26N2O2
Molecular Weight 362.46 da
Stereocenters 1/1