Molecular Definition

Canonical SMILES OCC(=O)[C@@]1(O)[C@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2CCC2=CC(=O)C=C[C@]12C)F
Formula C22H29FO5
Molecular Weight 392.46 da
Stereocenters 8/8