Molecular Definition

Canonical SMILES CC1=NC(NC2=NC=C(S2)C(=O)NC2=C(C)C=CC=C2Cl)=CC(=N1)N1CCN(CCO)CC1
Formula C22H26ClN7O2S
Molecular Weight 488.01 da
Stereocenters 0/0