Target Relevance

Molecular Definition

Canonical SMILES CC1=C(C=CC=C1)N1CCN(CCC2=NN=C3CCCCN23)CC1
Formula C19H27N5
Molecular Weight 325.45 da
Stereocenters 0/0