Molecular Definition

Canonical SMILES [H][C@]1(O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C1=CC(CC2=CC=C(OCC)C=C2)=C(Cl)C=C1
Formula C21H25ClO6
Molecular Weight 408.87 da
Stereocenters 5/5