Target Relevance

Molecular Definition

Canonical SMILES CCCCCCOC(=O)NC(=N)C1=CC=C(NCC2=NC3=CC(=CC=C3N2C)C(=O)N(CCC(=O)OCC)C2=NC=CC=C2)C=C1
Formula C34H41N7O5
Molecular Weight 627.73 da
Stereocenters 0/0