Molecular Definition

Canonical SMILES [H][C@@]12CC[C@](O)(C(=O)COC(C)=O)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C
Formula C23H30O6
Molecular Weight 402.48 da
Stereocenters 6/6