Molecular Definition

Canonical SMILES C[C@H](N)[C@H](O)c1ccc(O)c(O)c1
Formula C9H13NO3
Molecular Weight 183.20 da
Stereocenters 2/2