Molecular Definition

Canonical SMILES CCOC(=O)C(C)(C)OC1=CC=C(Cl)C=C1
Formula C12H15ClO3
Molecular Weight 242.70 da
Stereocenters 0/0