Synonym

Molecular Definition

Canonical SMILES OC(=O)CC(O)(CC(O)=O)C(O)=O
Formula C6H8O7
Molecular Weight 192.12 da
Stereocenters 0/0