Target Relevance

Molecular Definition

Canonical SMILES OC(=O)C1=CN(C2CC2)C2=CC(N3CCNCC3)=C(F)C=C2C1=O
Formula C17H18FN3O3
Molecular Weight 331.34 da
Stereocenters 0/0