Molecular Definition

Canonical SMILES CC(C)(OC1=CC=C(C=C1)C1CC1(Cl)Cl)C(O)=O
Formula C13H14Cl2O3
Molecular Weight 289.15 da
Stereocenters 0/1