Molecular Definition

Canonical SMILES CCCCOC1=NC2=CC=CC=C2C(=C1)C(=O)NCCN(CC)CC
Formula C20H29N3O2
Molecular Weight 343.46 da
Stereocenters 0/0