Molecular Definition

Canonical SMILES N#CNC(=NC)NCCSCc1nc[nH]c1C
Formula C10H16N6S
Molecular Weight 252.34 da
Stereocenters 0/0