Target Relevance

Molecular Definition

Canonical SMILES [H][C@@]1(CC1(C)C)C(=O)N\C(=C/CCCCSC[C@H](N)C(O)=O)C(O)=O
Formula C16H26N2O5S
Molecular Weight 358.45 da
Stereocenters 2/2