Molecular Definition

Canonical SMILES CC(C)(OC1=CC=C(C=C1)C(=O)C1=CC=C(Cl)C=C1)C(O)=O
Formula C17H15ClO4
Molecular Weight 318.75 da
Stereocenters 0/0