Molecular Definition

Canonical SMILES NS(=O)(=O)c1cc(ccc1Cl)C2(O)NC(=O)c3ccccc23
Formula C14H11ClN2O4S
Molecular Weight 338.77 da
Stereocenters 0/1