Target Relevance

Molecular Definition

Canonical SMILES COC1=CC=C(C=C1)C(Cl)=C(C1=CC=C(OC)C=C1)C1=CC=C(OC)C=C1
Formula C23H21ClO3
Molecular Weight 380.86 da
Stereocenters 0/0