Molecular Definition

Canonical SMILES CCN(CC)CCOC(=O)C1=C(Cl)C=C(N)C=C1
Formula C13H19ClN2O2
Molecular Weight 270.76 da
Stereocenters 0/0