Molecular Definition

Canonical SMILES NC1=CC(F)=CC=C1NC(=O)C1=CC=C(CNC(=O)\C=C\C2=CC=CN=C2)C=C1
Formula C22H19FN4O2
Molecular Weight 390.41 da
Stereocenters 0/0