Molecular Definition

Canonical SMILES C[C@@H](N(C)C(=O)N1CC[C@@H](C[C@@H]1C1=C(C)C=C(F)C=C1)N1CCN(CC1)C(C)=O)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F
Formula C30H35F7N4O2
Molecular Weight 616.61 da
Stereocenters 3/3