Molecular Definition

Canonical SMILES NC(=O)N1C2=CC=CC=C2C=CC2=C1C=CC=C2
Formula C15H12N2O
Molecular Weight 236.27 da
Stereocenters 0/0