Molecular Definition

Canonical SMILES CCCCCc1cc(O)c(c(c1)O)[C@@H]1C=C(C)CC[C@H]1C(=C)C
Formula C21H30O2
Molecular Weight 314.46 da
Stereocenters 2/2