Molecular Definition

Canonical SMILES [H][C@@]1(CC[C@@]2([H])\C(CCC[C@]12C)=C\C=C1\C[C@@H](O)C[C@H](O)C1=C)[C@H](C)CCCC(C)(C)O
Formula C27H44O3
Molecular Weight 416.64 da
Stereocenters 6/6