Molecular Definition

Canonical SMILES Cn1cnc2c1c(=O)n(C)c(=O)n2C
Formula C8H10N4O2
Molecular Weight 194.19 da
Stereocenters 0/0