Target Relevance

Molecular Definition

Canonical SMILES CCNC(=O)N(CCCN(C)C)C(=O)[C@@H]1C[C@H]2[C@@H](Cc3c[nH]c4cccc2c34)N(CC=C)C1
Formula C26H37N5O2
Molecular Weight 451.60 da
Stereocenters 3/3