Molecular Definition

Canonical SMILES [H][C@](O)(C(=O)O[C@@]1([H])C[C@@]2(O)[C@@]([H])(OC(=O)C3=CC=CC=C3)[C@]3([H])[C@@]4(CO[C@]4([H])C[C@]([H])(OC)[C@@]3(C)C(=O)[C@]([H])(OC)C(=C1C)C2(C)C)OC(C)=O)[C@@]([H])(NC(=O)OC(C)(C)C)C1=CC=CC=C1
Formula C45H57NO14
Molecular Weight 835.93 da
Stereocenters 11/11