Molecular Definition

Canonical SMILES CC1=CC(OCC(O)CNC(C)(C)C)=C(Cl)C=C1
Formula C14H22ClNO2
Molecular Weight 271.78 da
Stereocenters 0/1