Molecular Definition

Canonical SMILES CCCCN1CCCCC1C(=O)Nc1c(C)cccc1C
Formula C18H28N2O
Molecular Weight 288.43 da
Stereocenters 0/1