Molecular Definition

Canonical SMILES CCCC(=O)N1CCCN(CC1)C1=NC2=CC(OC)=C(OC)C=C2C(N)=N1
Formula C19H27N5O3
Molecular Weight 373.45 da
Stereocenters 0/0