Molecular Definition

Canonical SMILES CCCCNC1=C(OC2=CC=CC=C2)C(=CC(=C1)C(O)=O)S(N)(=O)=O
Formula C17H20N2O5S
Molecular Weight 364.42 da
Stereocenters 0/0