Target Relevance

Molecular Definition

Canonical SMILES [H][C@@](CC)(N1C[C@]([H])(CCC)CC1=O)C(N)=O
Formula C11H20N2O2
Molecular Weight 212.29 da
Stereocenters 2/2