Target Relevance

Molecular Definition

Canonical SMILES O=C1NC2=C(C=C1)C=CC(OCCCCN1CCN(CC1)C1=C3C=CSC3=CC=C1)=C2
Formula C25H27N3O2S
Molecular Weight 433.57 da
Stereocenters 0/0