Molecular Definition

Canonical SMILES COc1cc(Nc2c(cnc3cc(OCCCN4CCN(C)CC4)c(OC)cc23)C#N)c(Cl)cc1Cl
Formula C26H29Cl2N5O3
Molecular Weight 530.45 da
Stereocenters 0/0